C16H26FN3O — CID 83111882
N'-[2-(cyclopropylmethoxy)ethyl]-1-(5-fluoro-2-pyridinyl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 83111882) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is N'-[2-(cyclopropylmethoxy)ethyl]-1-(5-fluoro-2-pyridinyl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-[2-(cyclopropylmethoxy)ethyl]-1-(5-fluoro-2-pyridinyl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 83111882 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N'-[2-(cyclopropylmethoxy)ethyl]-1-(5-fluoro-2-pyridinyl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNC(CCN(C)CCOCC1CC1)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H26FN3O/c1-18-15(16-6-5-14(17)11-19-16)7-8-20(2)9-10-21-12-13-3-4-13/h5-6,11,13,15,18H,3-4,7-10,12H2,1-2H3 |
| InChIKey | LNHLQUWRWNOMBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|