C12H20FN3O — CID 83125861
2-[[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-ethylamino]ethanol (PubChem CID 83125861) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-[[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-ethylamino]ethanol.
| Compound Name | 2-[[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 83125861 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-[[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-ethylamino]ethanol |
| SMILES | CCN(CCO)CCC(N)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H20FN3O/c1-2-16(7-8-17)6-5-11(14)12-4-3-10(13)9-15-12/h3-4,9,11,17H,2,5-8,14H2,1H3 |
| InChIKey | MOFPBVUPZVDJGS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |