C16H27FN2 — CID 79712767
N,3-diethyl-1-(5-fluoro-2-pyridinyl)heptan-1-amine (PubChem CID 79712767) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is N,3-diethyl-1-(5-fluoro-2-pyridinyl)heptan-1-amine.
| Compound Name | N,3-diethyl-1-(5-fluoro-2-pyridinyl)heptan-1-amine |
|---|---|
| PubChem CID | 79712767 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | N,3-diethyl-1-(5-fluoro-2-pyridinyl)heptan-1-amine |
| SMILES | CCCCC(CC)CC(NCC)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H27FN2/c1-4-7-8-13(5-2)11-16(18-6-3)15-10-9-14(17)12-19-15/h9-10,12-13,16,18H,4-8,11H2,1-3H3 |
| InChIKey | IEWBDQMSFZTNCD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |