C17H29FN2O — CID 62644893
2-[[3-(4-fluorophenyl)-3-(methylamino)propyl]-pentan-3-ylamino]ethanol (PubChem CID 62644893) has the molecular formula C17H29FN2O and a molecular weight of 296.43 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-3-(methylamino)propyl]-pentan-3-ylamino]ethanol.
| Compound Name | 2-[[3-(4-fluorophenyl)-3-(methylamino)propyl]-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 62644893 |
| Molecular Formula | C17H29FN2O |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-3-(methylamino)propyl]-pentan-3-ylamino]ethanol |
| SMILES | CCC(CC)N(CCO)CCC(NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H29FN2O/c1-4-16(5-2)20(12-13-21)11-10-17(19-3)14-6-8-15(18)9-7-14/h6-9,16-17,19,21H,4-5,10-13H2,1-3H3 |
| InChIKey | GYIFSUOIEMGNRN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |