C15H25FN2 — CID 62644081
N,N',N'-triethyl-1-(3-fluorophenyl)propane-1,3-diamine (PubChem CID 62644081) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is N,N',N'-triethyl-1-(3-fluorophenyl)propane-1,3-diamine.
| Compound Name | N,N',N'-triethyl-1-(3-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62644081 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N,N',N'-triethyl-1-(3-fluorophenyl)propane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CC)c1cccc(F)c1 |
| InChI | InChI=1S/C15H25FN2/c1-4-17-15(10-11-18(5-2)6-3)13-8-7-9-14(16)12-13/h7-9,12,15,17H,4-6,10-11H2,1-3H3 |
| InChIKey | FTAAXVRDESMNJM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |