C15H24F2N2 — CID 79087248
1-(2,4-difluorophenyl)-N,N',N'-triethylpropane-1,3-diamine (PubChem CID 79087248) has the molecular formula C15H24F2N2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N,N',N'-triethylpropane-1,3-diamine.
| Compound Name | 1-(2,4-difluorophenyl)-N,N',N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79087248 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N,N',N'-triethylpropane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CC)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H24F2N2/c1-4-18-15(9-10-19(5-2)6-3)13-8-7-12(16)11-14(13)17/h7-8,11,15,18H,4-6,9-10H2,1-3H3 |
| InChIKey | ZJJHVKBOGAPNID-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |