C13H21F2N3 — CID 105244099
3-(2,4-difluorophenyl)-N,N-diethyl-3-hydrazinylpropan-1-amine (PubChem CID 105244099) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N,N-diethyl-3-hydrazinylpropan-1-amine.
| Compound Name | 3-(2,4-difluorophenyl)-N,N-diethyl-3-hydrazinylpropan-1-amine |
|---|---|
| PubChem CID | 105244099 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N,N-diethyl-3-hydrazinylpropan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H21F2N3/c1-3-18(4-2)8-7-13(17-16)11-6-5-10(14)9-12(11)15/h5-6,9,13,17H,3-4,7-8,16H2,1-2H3 |
| InChIKey | IMQYFYDSUXFKLB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|