C12H21FN4 — CID 105244160
N,N-diethyl-3-(5-fluoro-3-pyridinyl)-3-hydrazinylpropan-1-amine (PubChem CID 105244160) has the molecular formula C12H21FN4 and a molecular weight of 240.33 g/mol. Its IUPAC name is N,N-diethyl-3-(5-fluoro-3-pyridinyl)-3-hydrazinylpropan-1-amine.
| Compound Name | N,N-diethyl-3-(5-fluoro-3-pyridinyl)-3-hydrazinylpropan-1-amine |
|---|---|
| PubChem CID | 105244160 |
| Molecular Formula | C12H21FN4 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N,N-diethyl-3-(5-fluoro-3-pyridinyl)-3-hydrazinylpropan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1cncc(F)c1 |
| InChI | InChI=1S/C12H21FN4/c1-3-17(4-2)6-5-12(16-14)10-7-11(13)9-15-8-10/h7-9,12,16H,3-6,14H2,1-2H3 |
| InChIKey | JXUUVFVMERIRAT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|