C9H14FN3O — CID 105206466
[1-(5-fluoro-3-pyridinyl)-3-methoxypropyl]hydrazine (PubChem CID 105206466) has the molecular formula C9H14FN3O and a molecular weight of 199.23 g/mol. Its IUPAC name is [1-(5-fluoro-3-pyridinyl)-3-methoxypropyl]hydrazine.
| Compound Name | [1-(5-fluoro-3-pyridinyl)-3-methoxypropyl]hydrazine |
|---|---|
| PubChem CID | 105206466 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [1-(5-fluoro-3-pyridinyl)-3-methoxypropyl]hydrazine |
| SMILES | COCCC(NN)c1cncc(F)c1 |
| InChI | InChI=1S/C9H14FN3O/c1-14-3-2-9(13-11)7-4-8(10)6-12-5-7/h4-6,9,13H,2-3,11H2,1H3 |
| InChIKey | XYVNHLLPNQPNFM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|