C11H17F2N3O — CID 103151752
[3-(2,2-difluoroethoxy)-1-(5-methyl-3-pyridinyl)propyl]hydrazine (PubChem CID 103151752) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-(5-methyl-3-pyridinyl)propyl]hydrazine.
| Compound Name | [3-(2,2-difluoroethoxy)-1-(5-methyl-3-pyridinyl)propyl]hydrazine |
|---|---|
| PubChem CID | 103151752 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-(5-methyl-3-pyridinyl)propyl]hydrazine |
| SMILES | Cc1cncc(C(CCOCC(F)F)NN)c1 |
| InChI | InChI=1S/C11H17F2N3O/c1-8-4-9(6-15-5-8)10(16-14)2-3-17-7-11(12)13/h4-6,10-11,16H,2-3,7,14H2,1H3 |
| InChIKey | LIQCWYSBVYAYJS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|