C13H18F2O2 — CID 103147761
3-(2,2-difluoroethoxy)-1-(3,5-dimethylphenyl)propan-1-ol (PubChem CID 103147761) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3,5-dimethylphenyl)propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3,5-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 103147761 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3,5-dimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(C)cc(C(O)CCOCC(F)F)c1 |
| InChI | InChI=1S/C13H18F2O2/c1-9-5-10(2)7-11(6-9)12(16)3-4-17-8-13(14)15/h5-7,12-13,16H,3-4,8H2,1-2H3 |
| InChIKey | AWGCIPHGTKUSTC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|