C12H15F3O — CID 64565140
1-(3,5-dimethylphenyl)-4,4,4-trifluorobutan-1-ol (PubChem CID 64565140) has the molecular formula C12H15F3O and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(3,5-dimethylphenyl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 64565140 |
| Molecular Formula | C12H15F3O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4,4,4-trifluorobutan-1-ol |
| SMILES | Cc1cc(C)cc(C(O)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O/c1-8-5-9(2)7-10(6-8)11(16)3-4-12(13,14)15/h5-7,11,16H,3-4H2,1-2H3 |
| InChIKey | NADKSNDMTZOBAC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |