C11H14F4N2 — CID 105249105
[4,4,4-trifluoro-1-(3-fluoro-5-methylphenyl)butyl]hydrazine (PubChem CID 105249105) has the molecular formula C11H14F4N2 and a molecular weight of 250.24 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(3-fluoro-5-methylphenyl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(3-fluoro-5-methylphenyl)butyl]hydrazine |
|---|---|
| PubChem CID | 105249105 |
| Molecular Formula | C11H14F4N2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [4,4,4-trifluoro-1-(3-fluoro-5-methylphenyl)butyl]hydrazine |
| SMILES | Cc1cc(F)cc(C(CCC(F)(F)F)NN)c1 |
| InChI | InChI=1S/C11H14F4N2/c1-7-4-8(6-9(12)5-7)10(17-16)2-3-11(13,14)15/h4-6,10,17H,2-3,16H2,1H3 |
| InChIKey | RLZUGZALYKEORF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|