C13H19F3N2O3 — CID 105313821
[4,4,4-trifluoro-1-(3,4,5-trimethoxyphenyl)butyl]hydrazine (PubChem CID 105313821) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(3,4,5-trimethoxyphenyl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(3,4,5-trimethoxyphenyl)butyl]hydrazine |
|---|---|
| PubChem CID | 105313821 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [4,4,4-trifluoro-1-(3,4,5-trimethoxyphenyl)butyl]hydrazine |
| SMILES | COc1cc(C(CCC(F)(F)F)NN)cc(OC)c1OC |
| InChI | InChI=1S/C13H19F3N2O3/c1-19-10-6-8(7-11(20-2)12(10)21-3)9(18-17)4-5-13(14,15)16/h6-7,9,18H,4-5,17H2,1-3H3 |
| InChIKey | COTHSULTSSJPDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|