C14H24N2O3 — CID 116948624
N,N'-dimethyl-1-(3,4,5-trimethoxyphenyl)propane-1,3-diamine (PubChem CID 116948624) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is N,N'-dimethyl-1-(3,4,5-trimethoxyphenyl)propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-1-(3,4,5-trimethoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116948624 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N,N'-dimethyl-1-(3,4,5-trimethoxyphenyl)propane-1,3-diamine |
| SMILES | CNCCC(NC)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H24N2O3/c1-15-7-6-11(16-2)10-8-12(17-3)14(19-5)13(9-10)18-4/h8-9,11,15-16H,6-7H2,1-5H3 |
| InChIKey | AFXHKOWQMYKISU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |