C14H23NO5 — CID 171891111
4-(methylamino)-1-(3,4,5-trimethoxyphenyl)butane-1,2-diol (PubChem CID 171891111) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(methylamino)-1-(3,4,5-trimethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-(methylamino)-1-(3,4,5-trimethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171891111 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-(methylamino)-1-(3,4,5-trimethoxyphenyl)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H23NO5/c1-15-6-5-10(16)13(17)9-7-11(18-2)14(20-4)12(8-9)19-3/h7-8,10,13,15-17H,5-6H2,1-4H3 |
| InChIKey | TVZWZQKBDJLTFJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |