C16H21NO3 — CID 171891027
1-(6-methoxynaphthalen-2-yl)-4-(methylamino)butane-1,2-diol (PubChem CID 171891027) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-(6-methoxynaphthalen-2-yl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(6-methoxynaphthalen-2-yl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171891027 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-(6-methoxynaphthalen-2-yl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C16H21NO3/c1-17-8-7-15(18)16(19)13-4-3-12-10-14(20-2)6-5-11(12)9-13/h3-6,9-10,15-19H,7-8H2,1-2H3 |
| InChIKey | CHZWKGPAJVJBCQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |