C13H19NO5 — CID 171890830
2-[1,2-dihydroxy-4-(methylamino)butyl]-4-methoxybenzoic acid (PubChem CID 171890830) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[1,2-dihydroxy-4-(methylamino)butyl]-4-methoxybenzoic acid.
| Compound Name | 2-[1,2-dihydroxy-4-(methylamino)butyl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 171890830 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[1,2-dihydroxy-4-(methylamino)butyl]-4-methoxybenzoic acid |
| SMILES | CNCCC(O)C(O)c1cc(OC)ccc1C(=O)O |
| InChI | InChI=1S/C13H19NO5/c1-14-6-5-11(15)12(16)10-7-8(19-2)3-4-9(10)13(17)18/h3-4,7,11-12,14-16H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | HPZJSFLWQGGTNS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |