2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid

C12H13NO5 — CID 171901579

IUPAC2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)c(C(O)C(O)CC#N)c1
InChIInChI=1S/C12H13NO5/c1-18-7-2-3-8(12(16)17)9(6-7)11(15)10(14)4-5-13/h2-3,6,10-11,14-15H,4H2,1H3,(H,16,17)
InChIKeySREJGFJQCOUPRA-UHFFFAOYSA-N
MW251.24 g/mol
LogP0.70
Rot. Bonds5

About 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid

2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid (PubChem CID 171901579) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid.

Molecular Properties

Compound Name2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid
PubChem CID171901579
Molecular FormulaC12H13NO5
Molecular Weight251.24 g/mol
Exact Mass251.08
IUPAC Name2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid
SMILESCOc1ccc(C(=O)O)c(C(O)C(O)CC#N)c1
InChIInChI=1S/C12H13NO5/c1-18-7-2-3-8(12(16)17)9(6-7)11(15)10(14)4-5-13/h2-3,6,10-11,14-15H,4H2,1H3,(H,16,17)
InChIKeySREJGFJQCOUPRA-UHFFFAOYSA-N
XLogP0.70
TPSA110.78 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.24
LogP ≤ 50.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid?
The IUPAC name of 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid (CID 171901579) is 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid.
What is the SMILES notation for 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid?
The canonical SMILES for 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid is COc1ccc(C(=O)O)c(C(O)C(O)CC#N)c1.
What is the InChIKey of 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid?
The InChIKey is SREJGFJQCOUPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5/c1-18-7-2-3-8(12(16)17)9(6-7)11(15)10(14)4-5-13/h2-3,6,10-11,14-15H,4H2,1H3,(H,16,17).
What are the key properties of 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid?
2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid has a molecular weight of 251.24 g/mol, XLogP of 0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-1,2-dihydroxypropyl)-4-methoxybenzoic acid is sourced from PubChem (CID 171901579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).