C11H14N2O3 — CID 171901094
4-(5-amino-2-methoxyphenyl)-3,4-dihydroxybutanenitrile (PubChem CID 171901094) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-(5-amino-2-methoxyphenyl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(5-amino-2-methoxyphenyl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901094 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-(5-amino-2-methoxyphenyl)-3,4-dihydroxybutanenitrile |
| SMILES | COc1ccc(N)cc1C(O)C(O)CC#N |
| InChI | InChI=1S/C11H14N2O3/c1-16-10-3-2-7(13)6-8(10)11(15)9(14)4-5-12/h2-3,6,9,11,14-15H,4,13H2,1H3 |
| InChIKey | ZYYHPNCGUKNPGM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|