C11H16N2O4 — CID 171899304
4-(4-amino-2-methoxyphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899304) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(4-amino-2-methoxyphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(4-amino-2-methoxyphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899304 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(4-amino-2-methoxyphenyl)-3,4-dihydroxybutanamide |
| SMILES | COc1cc(N)ccc1C(O)C(O)CC(N)=O |
| InChI | InChI=1S/C11H16N2O4/c1-17-9-4-6(12)2-3-7(9)11(16)8(14)5-10(13)15/h2-4,8,11,14,16H,5,12H2,1H3,(H2,13,15) |
| InChIKey | ZFOGXTAKVRQSTJ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|