C12H18N2O3 — CID 171899234
4-(4-amino-2,3-dimethylphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899234) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-(4-amino-2,3-dimethylphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(4-amino-2,3-dimethylphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899234 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-(4-amino-2,3-dimethylphenyl)-3,4-dihydroxybutanamide |
| SMILES | Cc1c(N)ccc(C(O)C(O)CC(N)=O)c1C |
| InChI | InChI=1S/C12H18N2O3/c1-6-7(2)9(13)4-3-8(6)12(17)10(15)5-11(14)16/h3-4,10,12,15,17H,5,13H2,1-2H3,(H2,14,16) |
| InChIKey | PAAQOGPSQXDSAW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|