C11H17N3O3 — CID 171899146
4-(4,5-diamino-2-methylphenyl)-3,4-dihydroxybutanamide (PubChem CID 171899146) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-(4,5-diamino-2-methylphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(4,5-diamino-2-methylphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899146 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4-(4,5-diamino-2-methylphenyl)-3,4-dihydroxybutanamide |
| SMILES | Cc1cc(N)c(N)cc1C(O)C(O)CC(N)=O |
| InChI | InChI=1S/C11H17N3O3/c1-5-2-7(12)8(13)3-6(5)11(17)9(15)4-10(14)16/h2-3,9,11,15,17H,4,12-13H2,1H3,(H2,14,16) |
| InChIKey | AOIVCKXGMLSRLR-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|