C10H15N3O — CID 175309990
2-(4,5-diamino-2-methylphenyl)propanamide (PubChem CID 175309990) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(4,5-diamino-2-methylphenyl)propanamide.
| Compound Name | 2-(4,5-diamino-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 175309990 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-(4,5-diamino-2-methylphenyl)propanamide |
| SMILES | Cc1cc(N)c(N)cc1C(C)C(N)=O |
| InChI | InChI=1S/C10H15N3O/c1-5-3-8(11)9(12)4-7(5)6(2)10(13)14/h3-4,6H,11-12H2,1-2H3,(H2,13,14) |
| InChIKey | HLYVTQOMWIHVCC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|