C8H10F2N2 — CID 171010491
4-(difluoromethyl)-5-methylbenzene-1,2-diamine (PubChem CID 171010491) has the molecular formula C8H10F2N2 and a molecular weight of 172.18 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-methylbenzene-1,2-diamine.
| Compound Name | 4-(difluoromethyl)-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 171010491 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-(difluoromethyl)-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(N)c(N)cc1C(F)F |
| InChI | InChI=1S/C8H10F2N2/c1-4-2-6(11)7(12)3-5(4)8(9)10/h2-3,8H,11-12H2,1H3 |
| InChIKey | VOYRPFATFOLYGA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|