C10H12F2N2S — CID 144676327
2-[4-amino-2-(difluoromethyl)-5-methylphenyl]ethanethioamide (PubChem CID 144676327) has the molecular formula C10H12F2N2S and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-[4-amino-2-(difluoromethyl)-5-methylphenyl]ethanethioamide.
| Compound Name | 2-[4-amino-2-(difluoromethyl)-5-methylphenyl]ethanethioamide |
|---|---|
| PubChem CID | 144676327 |
| Molecular Formula | C10H12F2N2S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-[4-amino-2-(difluoromethyl)-5-methylphenyl]ethanethioamide |
| SMILES | Cc1cc(CC(N)=S)c(C(F)F)cc1N |
| InChI | InChI=1S/C10H12F2N2S/c1-5-2-6(3-9(14)15)7(10(11)12)4-8(5)13/h2,4,10H,3,13H2,1H3,(H2,14,15) |
| InChIKey | IDOVCBNWVFZPQY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|