C11H16N2O2 — CID 63181130
2-(4-amino-2,5-dimethylphenoxy)propanamide (PubChem CID 63181130) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(4-amino-2,5-dimethylphenoxy)propanamide.
| Compound Name | 2-(4-amino-2,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 63181130 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(4-amino-2,5-dimethylphenoxy)propanamide |
| SMILES | Cc1cc(OC(C)C(N)=O)c(C)cc1N |
| InChI | InChI=1S/C11H16N2O2/c1-6-5-10(7(2)4-9(6)12)15-8(3)11(13)14/h4-5,8H,12H2,1-3H3,(H2,13,14) |
| InChIKey | DFNWYMZWYCEOHG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|