C12H21NO2 — CID 167518125
2,4-dimethyl-5-propan-2-yloxyaniline;methanol (PubChem CID 167518125) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2,4-dimethyl-5-propan-2-yloxyaniline;methanol.
| Compound Name | 2,4-dimethyl-5-propan-2-yloxyaniline;methanol |
|---|---|
| PubChem CID | 167518125 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2,4-dimethyl-5-propan-2-yloxyaniline;methanol |
| SMILES | CO.Cc1cc(C)c(OC(C)C)cc1N |
| InChI | InChI=1S/C11H17NO.CH4O/c1-7(2)13-11-6-10(12)8(3)5-9(11)4;1-2/h5-7H,12H2,1-4H3;2H,1H3 |
| InChIKey | JSTQYKSOPSDKQM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|