C12H17N3O3 — CID 63181045
2-(4-amino-2,5-dimethylphenoxy)-N-carbamoylpropanamide (PubChem CID 63181045) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(4-amino-2,5-dimethylphenoxy)-N-carbamoylpropanamide.
| Compound Name | 2-(4-amino-2,5-dimethylphenoxy)-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 63181045 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(4-amino-2,5-dimethylphenoxy)-N-carbamoylpropanamide |
| SMILES | Cc1cc(OC(C)C(=O)NC(N)=O)c(C)cc1N |
| InChI | InChI=1S/C12H17N3O3/c1-6-5-10(7(2)4-9(6)13)18-8(3)11(16)15-12(14)17/h4-5,8H,13H2,1-3H3,(H3,14,15,16,17) |
| InChIKey | KEYDNISXPHXOKL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|