C12H17N3O5S — CID 82913324
N-carbamoyl-2-(2,5-dimethyl-4-sulfamoylphenoxy)propanamide (PubChem CID 82913324) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-carbamoyl-2-(2,5-dimethyl-4-sulfamoylphenoxy)propanamide.
| Compound Name | N-carbamoyl-2-(2,5-dimethyl-4-sulfamoylphenoxy)propanamide |
|---|---|
| PubChem CID | 82913324 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-carbamoyl-2-(2,5-dimethyl-4-sulfamoylphenoxy)propanamide |
| SMILES | Cc1cc(S(N)(=O)=O)c(C)cc1OC(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H17N3O5S/c1-6-5-10(21(14,18)19)7(2)4-9(6)20-8(3)11(16)15-12(13)17/h4-5,8H,1-3H3,(H2,14,18,19)(H3,13,15,16,17) |
| InChIKey | MOAIGIGJFOUEEB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |