C11H15N3O4 — CID 55036205
2-(4-amino-2-methoxyphenoxy)-N-carbamoylpropanamide (PubChem CID 55036205) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(4-amino-2-methoxyphenoxy)-N-carbamoylpropanamide.
| Compound Name | 2-(4-amino-2-methoxyphenoxy)-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 55036205 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(4-amino-2-methoxyphenoxy)-N-carbamoylpropanamide |
| SMILES | COc1cc(N)ccc1OC(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H15N3O4/c1-6(10(15)14-11(13)16)18-8-4-3-7(12)5-9(8)17-2/h3-6H,12H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | DVAPSJFILUPOBX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|