C11H15N3O5S — CID 81206957
2-(4-amino-2-methoxyphenyl)sulfonyl-N-carbamoylpropanamide (PubChem CID 81206957) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-(4-amino-2-methoxyphenyl)sulfonyl-N-carbamoylpropanamide.
| Compound Name | 2-(4-amino-2-methoxyphenyl)sulfonyl-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 81206957 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-(4-amino-2-methoxyphenyl)sulfonyl-N-carbamoylpropanamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)C(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H15N3O5S/c1-6(10(15)14-11(13)16)20(17,18)9-4-3-7(12)5-8(9)19-2/h3-6H,12H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | XYYIWXONDXPDPN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|