About 6-methyl-5-propan-2-yloxypyridine-2,3-diamine
6-methyl-5-propan-2-yloxypyridine-2,3-diamine (PubChem CID 130057867) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yloxypyridine-2,3-diamine.
Molecular Properties
| Compound Name | 6-methyl-5-propan-2-yloxypyridine-2,3-diamine |
| PubChem CID | 130057867 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 6-methyl-5-propan-2-yloxypyridine-2,3-diamine |
| SMILES | Cc1nc(N)c(N)cc1OC(C)C |
| InChI | InChI=1S/C9H15N3O/c1-5(2)13-8-4-7(10)9(11)12-6(8)3/h4-5H,10H2,1-3H3,(H2,11,12) |
| InChIKey | QZRLYVLJTPVIHC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-5-propan-2-yloxypyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-propan-2-yloxypyridine-2,3-diamine?
The IUPAC name of 6-methyl-5-propan-2-yloxypyridine-2,3-diamine (CID 130057867) is 6-methyl-5-propan-2-yloxypyridine-2,3-diamine.
What is the SMILES notation for 6-methyl-5-propan-2-yloxypyridine-2,3-diamine?
The canonical SMILES for 6-methyl-5-propan-2-yloxypyridine-2,3-diamine is Cc1nc(N)c(N)cc1OC(C)C.
What is the InChIKey of 6-methyl-5-propan-2-yloxypyridine-2,3-diamine?
The InChIKey is QZRLYVLJTPVIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5(2)13-8-4-7(10)9(11)12-6(8)3/h4-5H,10H2,1-3H3,(H2,11,12).
What are the key properties of 6-methyl-5-propan-2-yloxypyridine-2,3-diamine?
6-methyl-5-propan-2-yloxypyridine-2,3-diamine has a molecular weight of 181.24 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-propan-2-yloxypyridine-2,3-diamine is sourced from PubChem (CID 130057867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).