C12H16N2O5 — CID 171899846
2-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-methoxybenzamide (PubChem CID 171899846) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-methoxybenzamide.
| Compound Name | 2-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 171899846 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(4-amino-1,2-dihydroxy-4-oxobutyl)-5-methoxybenzamide |
| SMILES | COc1ccc(C(O)C(O)CC(N)=O)c(C(N)=O)c1 |
| InChI | InChI=1S/C12H16N2O5/c1-19-6-2-3-7(8(4-6)12(14)18)11(17)9(15)5-10(13)16/h2-4,9,11,15,17H,5H2,1H3,(H2,13,16)(H2,14,18) |
| InChIKey | BGPHOJGSHJFHAI-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |