C13H17NO5S — CID 170822606
S-[3-(2-carbamoyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170822606) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is S-[3-(2-carbamoyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(2-carbamoyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170822606 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | S-[3-(2-carbamoyl-4-methoxyphenyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | COc1ccc(C(O)C(O)CSC(C)=O)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-7(15)20-6-11(16)12(17)9-4-3-8(19-2)5-10(9)13(14)18/h3-5,11-12,16-17H,6H2,1-2H3,(H2,14,18) |
| InChIKey | CXFRSIMRJYFSGC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|