C12H16O6 — CID 171872914
5-methoxy-2-(1,2,4-trihydroxybutyl)benzoic acid (PubChem CID 171872914) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 5-methoxy-2-(1,2,4-trihydroxybutyl)benzoic acid.
| Compound Name | 5-methoxy-2-(1,2,4-trihydroxybutyl)benzoic acid |
|---|---|
| PubChem CID | 171872914 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-methoxy-2-(1,2,4-trihydroxybutyl)benzoic acid |
| SMILES | COc1ccc(C(O)C(O)CCO)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H16O6/c1-18-7-2-3-8(9(6-7)12(16)17)11(15)10(14)4-5-13/h2-3,6,10-11,13-15H,4-5H2,1H3,(H,16,17) |
| InChIKey | GSGZCADYMULHRI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |