C11H15NO6 — CID 171873010
1-(4-methoxy-2-nitrophenyl)butane-1,2,4-triol (PubChem CID 171873010) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is 1-(4-methoxy-2-nitrophenyl)butane-1,2,4-triol.
| Compound Name | 1-(4-methoxy-2-nitrophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873010 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(4-methoxy-2-nitrophenyl)butane-1,2,4-triol |
| SMILES | COc1ccc(C(O)C(O)CCO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15NO6/c1-18-7-2-3-8(9(6-7)12(16)17)11(15)10(14)4-5-13/h2-3,6,10-11,13-15H,4-5H2,1H3 |
| InChIKey | AUZXXWHTOVKPEM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|