C11H15NO5 — CID 171899043
3,4-dihydroxy-4-(2-hydroxy-3-methoxyphenyl)butanamide (PubChem CID 171899043) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-hydroxy-3-methoxyphenyl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(2-hydroxy-3-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 171899043 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3,4-dihydroxy-4-(2-hydroxy-3-methoxyphenyl)butanamide |
| SMILES | COc1cccc(C(O)C(O)CC(N)=O)c1O |
| InChI | InChI=1S/C11H15NO5/c1-17-8-4-2-3-6(11(8)16)10(15)7(13)5-9(12)14/h2-4,7,10,13,15-16H,5H2,1H3,(H2,12,14) |
| InChIKey | JBCLCPKZDRGIGF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |