C10H14N2O3 — CID 170875664
3-amino-3-(2-hydroxy-3-methoxyphenyl)propanamide (PubChem CID 170875664) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-amino-3-(2-hydroxy-3-methoxyphenyl)propanamide.
| Compound Name | 3-amino-3-(2-hydroxy-3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 170875664 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-amino-3-(2-hydroxy-3-methoxyphenyl)propanamide |
| SMILES | COc1cccc(C(N)CC(N)=O)c1O |
| InChI | InChI=1S/C10H14N2O3/c1-15-8-4-2-3-6(10(8)14)7(11)5-9(12)13/h2-4,7,14H,5,11H2,1H3,(H2,12,13) |
| InChIKey | RYGBRSRIDOSVPR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|