C10H11F3N2O3 — CID 170876399
3-amino-3-[2-hydroxy-3-(trifluoromethoxy)phenyl]propanamide (PubChem CID 170876399) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 3-amino-3-[2-hydroxy-3-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-amino-3-[2-hydroxy-3-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 170876399 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-amino-3-[2-hydroxy-3-(trifluoromethoxy)phenyl]propanamide |
| SMILES | NC(=O)CC(N)c1cccc(OC(F)(F)F)c1O |
| InChI | InChI=1S/C10H11F3N2O3/c11-10(12,13)18-7-3-1-2-5(9(7)17)6(14)4-8(15)16/h1-3,6,17H,4,14H2,(H2,15,16) |
| InChIKey | PSMKMSKBSZRKFQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|