C9H10F3NO3 — CID 66514766
2-[(1S)-1-amino-2-hydroxyethyl]-6-(trifluoromethoxy)phenol (PubChem CID 66514766) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-hydroxyethyl]-6-(trifluoromethoxy)phenol.
| Compound Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 66514766 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-(trifluoromethoxy)phenol |
| SMILES | N[C@H](CO)c1cccc(OC(F)(F)F)c1O |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)16-7-3-1-2-5(8(7)15)6(13)4-14/h1-3,6,14-15H,4,13H2/t6-/m1/s1 |
| InChIKey | KMTSQQCJICCHPQ-ZCFIWIBFSA-N |
| XLogP | 1.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|