C12H14F3NO2 — CID 171255529
2-[(S)-amino(cyclobutyl)methyl]-6-(trifluoromethoxy)phenol (PubChem CID 171255529) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[(S)-amino(cyclobutyl)methyl]-6-(trifluoromethoxy)phenol.
| Compound Name | 2-[(S)-amino(cyclobutyl)methyl]-6-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 171255529 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(S)-amino(cyclobutyl)methyl]-6-(trifluoromethoxy)phenol |
| SMILES | N[C@H](c1cccc(OC(F)(F)F)c1O)C1CCC1 |
| InChI | InChI=1S/C12H14F3NO2/c13-12(14,15)18-9-6-2-5-8(11(9)17)10(16)7-3-1-4-7/h2,5-7,10,17H,1,3-4,16H2/t10-/m0/s1 |
| InChIKey | YFCBODNJOQSCAL-JTQLQIEISA-N |
| XLogP | 3.09 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|