C12H17NO — CID 130061106
3-[amino(cyclobutyl)methyl]-2-methylphenol (PubChem CID 130061106) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3-[amino(cyclobutyl)methyl]-2-methylphenol.
| Compound Name | 3-[amino(cyclobutyl)methyl]-2-methylphenol |
|---|---|
| PubChem CID | 130061106 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3-[amino(cyclobutyl)methyl]-2-methylphenol |
| SMILES | Cc1c(O)cccc1C(N)C1CCC1 |
| InChI | InChI=1S/C12H17NO/c1-8-10(6-3-7-11(8)14)12(13)9-4-2-5-9/h3,6-7,9,12,14H,2,4-5,13H2,1H3 |
| InChIKey | YOLTVTGPKNTDRD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |