C13H20ClNO — CID 171212510
2-[(R)-amino(cyclopentyl)methyl]-6-methylphenol;hydrochloride (PubChem CID 171212510) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 2-[(R)-amino(cyclopentyl)methyl]-6-methylphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(cyclopentyl)methyl]-6-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171212510 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(R)-amino(cyclopentyl)methyl]-6-methylphenol;hydrochloride |
| SMILES | Cc1cccc([C@H](N)C2CCCC2)c1O.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-9-5-4-8-11(13(9)15)12(14)10-6-2-3-7-10;/h4-5,8,10,12,15H,2-3,6-7,14H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | UMMNARJZYZNUSO-UTONKHPSSA-N |
| XLogP | 3.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|