C13H16ClF4NO — CID 171208551
(R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine;hydrochloride (PubChem CID 171208551) has the molecular formula C13H16ClF4NO and a molecular weight of 313.72 g/mol. Its IUPAC name is (R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine;hydrochloride.
| Compound Name | (R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 171208551 |
| Molecular Formula | C13H16ClF4NO |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (R)-cyclobutyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccccc1OC(F)(F)C(F)F)C1CCC1 |
| InChI | InChI=1S/C13H15F4NO.ClH/c14-12(15)13(16,17)19-10-7-2-1-6-9(10)11(18)8-4-3-5-8;/h1-2,6-8,11-12H,3-5,18H2;1H/t11-;/m1./s1 |
| InChIKey | CYNPIRKVQGAESE-RFVHGSKJSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|