C19H26F4N2O — CID 171171176
1-[(R)-cyclohexyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine (PubChem CID 171171176) has the molecular formula C19H26F4N2O and a molecular weight of 374.42 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-cyclohexyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171171176 |
| Molecular Formula | C19H26F4N2O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[(R)-cyclohexyl-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)C(F)(F)Oc1ccccc1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C19H26F4N2O/c20-18(21)19(22,23)26-16-9-5-4-8-15(16)17(14-6-2-1-3-7-14)25-12-10-24-11-13-25/h4-5,8-9,14,17-18,24H,1-3,6-7,10-13H2/t17-/m1/s1 |
| InChIKey | PBIVGMGSTPWFEZ-QGZVFWFLSA-N |
| XLogP | 4.45 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|