C18H26ClF3N2S — CID 171172586
1-[(R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171172586) has the molecular formula C18H26ClF3N2S and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-[(R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171172586 |
| Molecular Formula | C18H26ClF3N2S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[(R)-cyclohexyl-[2-(trifluoromethylsulfanyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)Sc1ccccc1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C18H25F3N2S.ClH/c19-18(20,21)24-16-9-5-4-8-15(16)17(14-6-2-1-3-7-14)23-12-10-22-11-13-23;/h4-5,8-9,14,17,22H,1-3,6-7,10-13H2;1H/t17-;/m1./s1 |
| InChIKey | WUTKUHUOUXERNW-UNTBIKODSA-N |
| XLogP | 5.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |