C18H28N2S — CID 171295889
1-[(R)-(2-tert-butylsulfanylphenyl)-cyclopropylmethyl]piperazine (PubChem CID 171295889) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclopropylmethyl]piperazine.
| Compound Name | 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclopropylmethyl]piperazine |
|---|---|
| PubChem CID | 171295889 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclopropylmethyl]piperazine |
| SMILES | CC(C)(C)Sc1ccccc1[C@@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C18H28N2S/c1-18(2,3)21-16-7-5-4-6-15(16)17(14-8-9-14)20-12-10-19-11-13-20/h4-7,14,17,19H,8-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | RJTHVABLGMTPLJ-QGZVFWFLSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |