C21H34N2S — CID 171295895
1-[(R)-(2-tert-butylsulfanylphenyl)-cyclohexylmethyl]piperazine (PubChem CID 171295895) has the molecular formula C21H34N2S and a molecular weight of 346.58 g/mol. Its IUPAC name is 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171295895 |
| Molecular Formula | C21H34N2S |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(R)-(2-tert-butylsulfanylphenyl)-cyclohexylmethyl]piperazine |
| SMILES | CC(C)(C)Sc1ccccc1[C@@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C21H34N2S/c1-21(2,3)24-19-12-8-7-11-18(19)20(17-9-5-4-6-10-17)23-15-13-22-14-16-23/h7-8,11-12,17,20,22H,4-6,9-10,13-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | LQXLZFMZGYAAPX-HXUWFJFHSA-N |
| XLogP | 5.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |