C16H24ClN3 — CID 171273137
1-[(S)-(2-chloro-3-pyridinyl)-cyclohexylmethyl]piperazine (PubChem CID 171273137) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is 1-[(S)-(2-chloro-3-pyridinyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(S)-(2-chloro-3-pyridinyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171273137 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[(S)-(2-chloro-3-pyridinyl)-cyclohexylmethyl]piperazine |
| SMILES | Clc1ncccc1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H24ClN3/c17-16-14(7-4-8-19-16)15(13-5-2-1-3-6-13)20-11-9-18-10-12-20/h4,7-8,13,15,18H,1-3,5-6,9-12H2/t15-/m0/s1 |
| InChIKey | KOFMCIBIZJKHFS-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|